C26H19F3N2O3 — CID 21374013
2-[[2-ethoxy-4-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 21374013) has the molecular formula C26H19F3N2O3 and a molecular weight of 464.44 g/mol. Its IUPAC name is 2-[[2-ethoxy-4-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-ethoxy-4-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 21374013 |
| Molecular Formula | C26H19F3N2O3 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[[2-ethoxy-4-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H19F3N2O3/c1-2-33-24-12-16(7-10-23(24)34-15-18-6-4-3-5-17(18)14-30)11-21-20-9-8-19(26(27,28)29)13-22(20)31-25(21)32/h3-13H,2,15H2,1H3,(H,31,32)/b21-11+ |
| InChIKey | DXAPVIRTGVVZNB-SRZZPIQSSA-N |
| XLogP | 6.05 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|