C25H20F3NO4 — CID 21374178
(3E)-3-[[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374178) has the molecular formula C25H20F3NO4 and a molecular weight of 455.43 g/mol. Its IUPAC name is (3E)-3-[[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374178 |
| Molecular Formula | C25H20F3NO4 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (3E)-3-[[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | COc1ccccc1OCCOc1ccc(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C25H20F3NO4/c1-31-22-4-2-3-5-23(22)33-13-12-32-18-9-6-16(7-10-18)14-20-19-11-8-17(25(26,27)28)15-21(19)29-24(20)30/h2-11,14-15H,12-13H2,1H3,(H,29,30)/b20-14+ |
| InChIKey | VKDNIHMAGVPCLG-XSFVSMFZSA-N |
| XLogP | 5.66 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|