C27H20ClN3O5 — CID 6250923
2-[[4-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 6250923) has the molecular formula C27H20ClN3O5 and a molecular weight of 501.93 g/mol. Its IUPAC name is 2-[[4-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 6250923 |
| Molecular Formula | C27H20ClN3O5 |
| Molecular Weight | 501.93 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2-[[4-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(Cl)cc3)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H20ClN3O5/c1-2-35-24-14-17(7-12-23(24)36-16-19-6-4-3-5-18(19)15-29)13-22-25(32)30-27(34)31(26(22)33)21-10-8-20(28)9-11-21/h3-14H,2,16H2,1H3,(H,30,32,34)/b22-13+ |
| InChIKey | OPDVVOGVILDGDY-LPYMAVHISA-N |
| XLogP | 4.86 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|