C30H24BrN3O5 — CID 124533532
2-[[4-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzonitrile (PubChem CID 124533532) has the molecular formula C30H24BrN3O5 and a molecular weight of 586.44 g/mol. Its IUPAC name is 2-[[4-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 124533532 |
| Molecular Formula | C30H24BrN3O5 |
| Molecular Weight | 586.44 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | 2-[[4-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzonitrile |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(Br)cc3)C2=O)cc(OCC)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C30H24BrN3O5/c1-3-7-20-14-19(16-26(38-4-2)27(20)39-18-22-9-6-5-8-21(22)17-32)15-25-28(35)33-30(37)34(29(25)36)24-12-10-23(31)11-13-24/h3,5-6,8-16H,1,4,7,18H2,2H3,(H,33,35,37)/b25-15+ |
| InChIKey | CPTVKVFCQHQEFE-MFKUBSTISA-N |
| XLogP | 5.69 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|