C33H31N3O7 — CID 124532208
2-[[4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzonitrile (PubChem CID 124532208) has the molecular formula C33H31N3O7 and a molecular weight of 581.63 g/mol. Its IUPAC name is 2-[[4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 124532208 |
| Molecular Formula | C33H31N3O7 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 2-[[4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzonitrile |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3cc(OCC)ccc3OCC)C2=O)cc(OC)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C33H31N3O7/c1-5-10-22-15-21(17-29(40-4)30(22)43-20-24-12-9-8-11-23(24)19-34)16-26-31(37)35-33(39)36(32(26)38)27-18-25(41-6-2)13-14-28(27)42-7-3/h5,8-9,11-18H,1,6-7,10,20H2,2-4H3,(H,35,37,39)/b26-16+ |
| InChIKey | ODCOKENFEQMJQZ-WGOQTCKBSA-N |
| XLogP | 5.34 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|