C29H26Cl2N2O7 — CID 124531972
(5E)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-(2,5-diethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 124531972) has the molecular formula C29H26Cl2N2O7 and a molecular weight of 585.44 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-(2,5-diethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-(2,5-diethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124531972 |
| Molecular Formula | C29H26Cl2N2O7 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | (5E)-5-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-(2,5-diethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccc(OCC)c(N2C(=O)NC(=O)/C(=C\c3cc(Cl)c(OCc4ccccc4Cl)c(OC)c3)C2=O)c1 |
| InChI | InChI=1S/C29H26Cl2N2O7/c1-4-38-19-10-11-24(39-5-2)23(15-19)33-28(35)20(27(34)32-29(33)36)12-17-13-22(31)26(25(14-17)37-3)40-16-18-8-6-7-9-21(18)30/h6-15H,4-5,16H2,1-3H3,(H,32,34,36)/b20-12+ |
| InChIKey | RLNBISQTXWOYMT-UDWIEESQSA-N |
| XLogP | 6.04 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|