C28H23Cl2IN2O6 — CID 124601192
(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-1-(2,5-diethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 124601192) has the molecular formula C28H23Cl2IN2O6 and a molecular weight of 681.31 g/mol. Its IUPAC name is (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-1-(2,5-diethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-1-(2,5-diethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124601192 |
| Molecular Formula | C28H23Cl2IN2O6 |
| Molecular Weight | 681.31 g/mol |
| Exact Mass | 680.00 |
| IUPAC Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-1-(2,5-diethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccc(OCC)c(N2C(=O)NC(=O)/C(=C\c3ccc(OCc4ccc(Cl)cc4Cl)c(I)c3)C2=O)c1 |
| InChI | InChI=1S/C28H23Cl2IN2O6/c1-3-37-19-8-10-25(38-4-2)23(14-19)33-27(35)20(26(34)32-28(33)36)11-16-5-9-24(22(31)12-16)39-15-17-6-7-18(29)13-21(17)30/h5-14H,3-4,15H2,1-2H3,(H,32,34,36)/b20-11+ |
| InChIKey | VUDQVKZYSSCQSF-RGVLZGJSSA-N |
| XLogP | 6.64 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.31 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|