C30H29IN2O7 — CID 124601152
(5E)-1-(2,5-diethoxyphenyl)-5-[[3-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124601152) has the molecular formula C30H29IN2O7 and a molecular weight of 656.47 g/mol. Its IUPAC name is (5E)-1-(2,5-diethoxyphenyl)-5-[[3-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(2,5-diethoxyphenyl)-5-[[3-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124601152 |
| Molecular Formula | C30H29IN2O7 |
| Molecular Weight | 656.47 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | (5E)-1-(2,5-diethoxyphenyl)-5-[[3-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccc(OCC)c(N2C(=O)NC(=O)/C(=C\c3ccc(OCc4ccc(I)cc4)c(OCC)c3)C2=O)c1 |
| InChI | InChI=1S/C30H29IN2O7/c1-4-37-22-12-14-25(38-5-2)24(17-22)33-29(35)23(28(34)32-30(33)36)15-20-9-13-26(27(16-20)39-6-3)40-18-19-7-10-21(31)11-8-19/h7-17H,4-6,18H2,1-3H3,(H,32,34,36)/b23-15+ |
| InChIKey | ORTKFKAURGSQAJ-HZHRSRAPSA-N |
| XLogP | 5.73 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|