C31H25N3O6S — CID 3325739
3-[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 3325739) has the molecular formula C31H25N3O6S and a molecular weight of 567.62 g/mol. Its IUPAC name is 3-[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3325739 |
| Molecular Formula | C31H25N3O6S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 3-[5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | C=CCc1cc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)cc(OCC)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C31H25N3O6S/c1-3-8-20-13-19(15-26(39-4-2)27(20)40-18-23-10-6-5-9-22(23)17-32)14-25-28(35)33-31(41)34(29(25)36)24-12-7-11-21(16-24)30(37)38/h3,5-7,9-16H,1,4,8,18H2,2H3,(H,37,38)(H,33,35,41) |
| InChIKey | CADKNORCRNMUHH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|