C30H24Cl2N2O6S — CID 4022100
3-[5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 4022100) has the molecular formula C30H24Cl2N2O6S and a molecular weight of 611.50 g/mol. Its IUPAC name is 3-[5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4022100 |
| Molecular Formula | C30H24Cl2N2O6S |
| Molecular Weight | 611.50 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | 3-[5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | C=CCc1cc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H24Cl2N2O6S/c1-3-6-18-11-17(13-25(39-4-2)26(18)40-16-20-9-10-21(31)15-24(20)32)12-23-27(35)33-30(41)34(28(23)36)22-8-5-7-19(14-22)29(37)38/h3,5,7-15H,1,4,6,16H2,2H3,(H,37,38)(H,33,35,41) |
| InChIKey | YVVGRLYPHDXJCA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|