C25H22N2O8S — CID 6106177
3-[(5E)-5-[[4-(carboxymethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 6106177) has the molecular formula C25H22N2O8S and a molecular weight of 510.52 g/mol. Its IUPAC name is 3-[(5E)-5-[[4-(carboxymethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[(5E)-5-[[4-(carboxymethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 6106177 |
| Molecular Formula | C25H22N2O8S |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 3-[(5E)-5-[[4-(carboxymethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)cc(OCC)c1OCC(=O)O |
| InChI | InChI=1S/C25H22N2O8S/c1-3-6-15-9-14(11-19(34-4-2)21(15)35-13-20(28)29)10-18-22(30)26-25(36)27(23(18)31)17-8-5-7-16(12-17)24(32)33/h3,5,7-12H,1,4,6,13H2,2H3,(H,28,29)(H,32,33)(H,26,30,36)/b18-10+ |
| InChIKey | DKUKZQCYTNFTAJ-VCHYOVAHSA-N |
| XLogP | 2.81 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|