C25H22N2O6S — CID 3484582
3-[5-[(3-methoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 3484582) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-[5-[(3-methoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[(3-methoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3484582 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 3-[5-[(3-methoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | C=CCOc1c(CC=C)cc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)cc1OC |
| InChI | InChI=1S/C25H22N2O6S/c1-4-7-16-11-15(13-20(32-3)21(16)33-10-5-2)12-19-22(28)26-25(34)27(23(19)29)18-9-6-8-17(14-18)24(30)31/h4-6,8-9,11-14H,1-2,7,10H2,3H3,(H,30,31)(H,26,28,34) |
| InChIKey | CBQQLBIJDWFAHM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|