C26H19BrN2O6S — CID 3953129
3-[5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 3953129) has the molecular formula C26H19BrN2O6S and a molecular weight of 567.42 g/mol. Its IUPAC name is 3-[5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3953129 |
| Molecular Formula | C26H19BrN2O6S |
| Molecular Weight | 567.42 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | 3-[5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | COc1cc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H19BrN2O6S/c1-34-21-12-16(11-20(27)22(21)35-14-15-6-3-2-4-7-15)10-19-23(30)28-26(36)29(24(19)31)18-9-5-8-17(13-18)25(32)33/h2-13H,14H2,1H3,(H,32,33)(H,28,30,36) |
| InChIKey | CNLLYFRHBZIRRS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|