C23H21BrN2O6S — CID 4004016
3-[5-[(3-bromo-4-butan-2-yloxy-5-methoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 4004016) has the molecular formula C23H21BrN2O6S and a molecular weight of 533.40 g/mol. Its IUPAC name is 3-[5-[(3-bromo-4-butan-2-yloxy-5-methoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[(3-bromo-4-butan-2-yloxy-5-methoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4004016 |
| Molecular Formula | C23H21BrN2O6S |
| Molecular Weight | 533.40 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 3-[5-[(3-bromo-4-butan-2-yloxy-5-methoxyphenyl)methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | CCC(C)Oc1c(Br)cc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)cc1OC |
| InChI | InChI=1S/C23H21BrN2O6S/c1-4-12(2)32-19-17(24)9-13(10-18(19)31-3)8-16-20(27)25-23(33)26(21(16)28)15-7-5-6-14(11-15)22(29)30/h5-12H,4H2,1-3H3,(H,29,30)(H,25,27,33) |
| InChIKey | HYJDYNPUOJLNLY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|