C30H27N3O3S — CID 126045893
2-[[2-ethoxy-4-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-prop-2-enylphenoxy]methyl]benzonitrile (PubChem CID 126045893) has the molecular formula C30H27N3O3S and a molecular weight of 509.63 g/mol. Its IUPAC name is 2-[[2-ethoxy-4-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-prop-2-enylphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-ethoxy-4-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-prop-2-enylphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126045893 |
| Molecular Formula | C30H27N3O3S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 2-[[2-ethoxy-4-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-prop-2-enylphenoxy]methyl]benzonitrile |
| SMILES | C=CCc1cc(/C=C2/C(=O)N(c3ccccc3)C(=S)N2C)cc(OCC)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C30H27N3O3S/c1-4-11-22-16-21(17-26-29(34)33(30(37)32(26)3)25-14-7-6-8-15-25)18-27(35-5-2)28(22)36-20-24-13-10-9-12-23(24)19-31/h4,6-10,12-18H,1,5,11,20H2,2-3H3/b26-17- |
| InChIKey | RCZLOTWGNZYMCO-ONUIUJJFSA-N |
| XLogP | 5.87 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|