C36H31BrN2O6 — CID 126070506
(5E)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126070506) has the molecular formula C36H31BrN2O6 and a molecular weight of 667.56 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126070506 |
| Molecular Formula | C36H31BrN2O6 |
| Molecular Weight | 667.56 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)cc(OCC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C36H31BrN2O6/c1-3-8-27-19-26(21-32(43-4-2)33(27)45-23-25-11-13-28(37)14-12-25)20-31-34(40)38-36(42)39(35(31)41)29-15-17-30(18-16-29)44-22-24-9-6-5-7-10-24/h3,5-7,9-21H,1,4,8,22-23H2,2H3,(H,38,40,42)/b31-20+ |
| InChIKey | BSXCPWDFLPUMLZ-AJBULDERSA-N |
| XLogP | 7.40 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.56 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|