C35H29BrN2O5 — CID 126073393
5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126073393) has the molecular formula C35H29BrN2O5 and a molecular weight of 637.53 g/mol. Its IUPAC name is 5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126073393 |
| Molecular Formula | C35H29BrN2O5 |
| Molecular Weight | 637.53 g/mol |
| Exact Mass | 636.13 |
| IUPAC Name | 5-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)cc(OCC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C35H29BrN2O5/c1-3-11-26-20-25(22-31(42-4-2)32(26)43-23-24-16-18-27(36)19-17-24)21-30-33(39)37(28-12-7-5-8-13-28)35(41)38(34(30)40)29-14-9-6-10-15-29/h3,5-10,12-22H,1,4,11,23H2,2H3 |
| InChIKey | NHFBRPIYIBAGNK-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.53 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|