C25H18Cl2N2O7S — CID 126074182
[4-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126074182) has the molecular formula C25H18Cl2N2O7S and a molecular weight of 561.40 g/mol. Its IUPAC name is [4-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126074182 |
| Molecular Formula | C25H18Cl2N2O7S |
| Molecular Weight | 561.40 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | [4-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(Cl)cc3)C2=O)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18Cl2N2O7S/c1-2-35-22-14-15(3-12-21(22)36-37(33,34)19-10-6-17(27)7-11-19)13-20-23(30)28-25(32)29(24(20)31)18-8-4-16(26)5-9-18/h3-14H,2H2,1H3,(H,28,30,32)/b20-13+ |
| InChIKey | ZPNYOCCBEBTYEV-DEDYPNTBSA-N |
| XLogP | 4.83 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|