C23H14Cl2N2O6S — CID 126077371
[2-chloro-4-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126077371) has the molecular formula C23H14Cl2N2O6S and a molecular weight of 517.35 g/mol. Its IUPAC name is [2-chloro-4-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126077371 |
| Molecular Formula | C23H14Cl2N2O6S |
| Molecular Weight | 517.35 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | [2-chloro-4-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1NC(=O)N(c2ccccc2)C(=O)/C1=C/c1ccc(OS(=O)(=O)c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C23H14Cl2N2O6S/c24-15-7-9-17(10-8-15)34(31,32)33-20-11-6-14(13-19(20)25)12-18-21(28)26-23(30)27(22(18)29)16-4-2-1-3-5-16/h1-13H,(H,26,28,30)/b18-12+ |
| InChIKey | ZWEPOOCXSHLUEP-LDADJPATSA-N |
| XLogP | 4.43 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|