C23H15ClN2O6S — CID 126076093
[2-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126076093) has the molecular formula C23H15ClN2O6S and a molecular weight of 482.90 g/mol. Its IUPAC name is [2-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126076093 |
| Molecular Formula | C23H15ClN2O6S |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | [2-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=C1NC(=O)N(c2ccc(Cl)cc2)C(=O)/C1=C/c1ccccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H15ClN2O6S/c24-16-10-12-17(13-11-16)26-22(28)19(21(27)25-23(26)29)14-15-6-4-5-9-20(15)32-33(30,31)18-7-2-1-3-8-18/h1-14H,(H,25,27,29)/b19-14+ |
| InChIKey | VOYYBQXESWPUDY-XMHGGMMESA-N |
| XLogP | 3.77 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|