C30H20Cl2N2O7S — CID 126076232
[4-chloro-2-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126076232) has the molecular formula C30H20Cl2N2O7S and a molecular weight of 623.47 g/mol. Its IUPAC name is [4-chloro-2-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-chloro-2-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126076232 |
| Molecular Formula | C30H20Cl2N2O7S |
| Molecular Weight | 623.47 g/mol |
| Exact Mass | 622.04 |
| IUPAC Name | [4-chloro-2-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1NC(=O)N(c2ccc(OCc3ccccc3)cc2)C(=O)/C1=C/c1cc(Cl)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H20Cl2N2O7S/c31-21-6-13-25(14-7-21)42(38,39)41-27-15-8-22(32)16-20(27)17-26-28(35)33-30(37)34(29(26)36)23-9-11-24(12-10-23)40-18-19-4-2-1-3-5-19/h1-17H,18H2,(H,33,35,37)/b26-17+ |
| InChIKey | XZBJNBQSMJIPHP-YZSQISJMSA-N |
| XLogP | 6.01 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|