C33H26ClN3O6 — CID 126258010
2-[4-chloro-2-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126258010) has the molecular formula C33H26ClN3O6 and a molecular weight of 596.04 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126258010 |
| Molecular Formula | C33H26ClN3O6 |
| Molecular Weight | 596.04 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(Cl)cc1/C=C1/C(=O)NC(=O)N(c2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C33H26ClN3O6/c1-21-7-5-6-10-28(21)35-30(38)20-43-29-16-11-24(34)17-23(29)18-27-31(39)36-33(41)37(32(27)40)25-12-14-26(15-13-25)42-19-22-8-3-2-4-9-22/h2-18H,19-20H2,1H3,(H,35,38)(H,36,39,41)/b27-18- |
| InChIKey | BWOCVGLEKXDDLT-IMRQLAEWSA-N |
| XLogP | 5.91 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.04 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|