C35H30IN3O7 — CID 126272190
2-[2-ethoxy-6-iodo-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126272190) has the molecular formula C35H30IN3O7 and a molecular weight of 731.54 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-6-iodo-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126272190 |
| Molecular Formula | C35H30IN3O7 |
| Molecular Weight | 731.54 g/mol |
| Exact Mass | 731.11 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)cc(I)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C35H30IN3O7/c1-3-44-30-19-24(18-28(36)32(30)46-21-31(40)37-29-12-8-7-9-22(29)2)17-27-33(41)38-35(43)39(34(27)42)25-13-15-26(16-14-25)45-20-23-10-5-4-6-11-23/h4-19H,3,20-21H2,1-2H3,(H,37,40)(H,38,41,43)/b27-17- |
| InChIKey | VTCSCJDVDWTFSA-PKAZHMFMSA-N |
| XLogP | 6.26 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|