C36H32BrN3O7 — CID 126264278
2-[2-bromo-6-ethoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126264278) has the molecular formula C36H32BrN3O7 and a molecular weight of 698.57 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126264278 |
| Molecular Formula | C36H32BrN3O7 |
| Molecular Weight | 698.57 g/mol |
| Exact Mass | 697.14 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)cc(Br)c1OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C36H32BrN3O7/c1-4-45-31-19-25(18-29(37)33(31)47-21-32(41)38-30-12-8-9-22(2)23(30)3)17-28-34(42)39-36(44)40(35(28)43)26-13-15-27(16-14-26)46-20-24-10-6-5-7-11-24/h5-19H,4,20-21H2,1-3H3,(H,38,41)(H,39,42,44)/b28-17- |
| InChIKey | TWNXQYPHNQQNAW-QRQIAZFYSA-N |
| XLogP | 6.73 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|