C36H33N3O7 — CID 126253349
N-(2,5-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126253349) has the molecular formula C36H33N3O7 and a molecular weight of 619.67 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126253349 |
| Molecular Formula | C36H33N3O7 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)ccc1OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C36H33N3O7/c1-4-44-32-20-26(12-17-31(32)46-22-33(40)37-30-18-23(2)10-11-24(30)3)19-29-34(41)38-36(43)39(35(29)42)27-13-15-28(16-14-27)45-21-25-8-6-5-7-9-25/h5-20H,4,21-22H2,1-3H3,(H,37,40)(H,38,41,43)/b29-19- |
| InChIKey | BMSNDSNBECQNAA-CEUNXORHSA-N |
| XLogP | 5.97 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|