C34H28ClN3O7 — CID 126223598
N-(4-chlorophenyl)-2-[2-ethoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126223598) has the molecular formula C34H28ClN3O7 and a molecular weight of 626.07 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-ethoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-ethoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126223598 |
| Molecular Formula | C34H28ClN3O7 |
| Molecular Weight | 626.07 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-ethoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)ccc1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H28ClN3O7/c1-2-43-30-19-23(8-17-29(30)45-21-31(39)36-25-11-9-24(35)10-12-25)18-28-32(40)37-34(42)38(33(28)41)26-13-15-27(16-14-26)44-20-22-6-4-3-5-7-22/h3-19H,2,20-21H2,1H3,(H,36,39)(H,37,40,42)/b28-18+ |
| InChIKey | CJTGHYOTDNMVRN-MTDXEUNCSA-N |
| XLogP | 6.00 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.07 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|