C35H29ClIN3O7 — CID 126269427
N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-6-iodo-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126269427) has the molecular formula C35H29ClIN3O7 and a molecular weight of 765.99 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-6-iodo-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-6-iodo-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126269427 |
| Molecular Formula | C35H29ClIN3O7 |
| Molecular Weight | 765.99 g/mol |
| Exact Mass | 765.07 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-6-iodo-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)cc(I)c1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C35H29ClIN3O7/c1-3-45-30-17-23(16-29(37)32(30)47-20-31(41)38-24-10-9-21(2)28(36)18-24)15-27-33(42)39-35(44)40(34(27)43)25-11-13-26(14-12-25)46-19-22-7-5-4-6-8-22/h4-18H,3,19-20H2,1-2H3,(H,38,41)(H,39,42,44)/b27-15- |
| InChIKey | KGEBLNABFJTLDC-DICXZTSXSA-N |
| XLogP | 6.91 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.99 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|