C27H21IN2O8 — CID 126055035
2-[2-iodo-6-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126055035) has the molecular formula C27H21IN2O8 and a molecular weight of 628.38 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-iodo-6-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126055035 |
| Molecular Formula | C27H21IN2O8 |
| Molecular Weight | 628.38 g/mol |
| Exact Mass | 628.03 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C27H21IN2O8/c1-36-22-13-17(12-21(28)24(22)38-15-23(31)32)11-20-25(33)29-27(35)30(26(20)34)18-7-9-19(10-8-18)37-14-16-5-3-2-4-6-16/h2-13H,14-15H2,1H3,(H,31,32)(H,29,33,35)/b20-11+ |
| InChIKey | STAGXHCVYVGYFK-RGVLZGJSSA-N |
| XLogP | 4.01 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|