C33H25ClN2O8 — CID 126080052
4-[[2-chloro-6-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126080052) has the molecular formula C33H25ClN2O8 and a molecular weight of 613.02 g/mol. Its IUPAC name is 4-[[2-chloro-6-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-6-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126080052 |
| Molecular Formula | C33H25ClN2O8 |
| Molecular Weight | 613.02 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 4-[[2-chloro-6-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H25ClN2O8/c1-42-28-17-22(16-27(34)29(28)44-19-21-7-9-23(10-8-21)32(39)40)15-26-30(37)35-33(41)36(31(26)38)24-11-13-25(14-12-24)43-18-20-5-3-2-4-6-20/h2-17H,18-19H2,1H3,(H,39,40)(H,35,37,41)/b26-15+ |
| InChIKey | RCJIASVXTOQWMV-CVKSISIWSA-N |
| XLogP | 5.87 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.02 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|