C28H22Cl2N2O6 — CID 46497577
4-[[2,6-dichloro-4-[(E)-[2,4,6-trioxo-1-(4-propan-2-ylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 46497577) has the molecular formula C28H22Cl2N2O6 and a molecular weight of 553.40 g/mol. Its IUPAC name is 4-[[2,6-dichloro-4-[(E)-[2,4,6-trioxo-1-(4-propan-2-ylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dichloro-4-[(E)-[2,4,6-trioxo-1-(4-propan-2-ylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 46497577 |
| Molecular Formula | C28H22Cl2N2O6 |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 4-[[2,6-dichloro-4-[(E)-[2,4,6-trioxo-1-(4-propan-2-ylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CC(C)c1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Cl)c(OCc4ccc(C(=O)O)cc4)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H22Cl2N2O6/c1-15(2)18-7-9-20(10-8-18)32-26(34)21(25(33)31-28(32)37)11-17-12-22(29)24(23(30)13-17)38-14-16-3-5-19(6-4-16)27(35)36/h3-13,15H,14H2,1-2H3,(H,35,36)(H,31,33,37)/b21-11+ |
| InChIKey | QLVAWZUKHUHILS-SRZZPIQSSA-N |
| XLogP | 6.06 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|