C25H16Cl2N2O7 — CID 126076891
4-[[2,4-dichloro-6-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126076891) has the molecular formula C25H16Cl2N2O7 and a molecular weight of 527.32 g/mol. Its IUPAC name is 4-[[2,4-dichloro-6-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,4-dichloro-6-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126076891 |
| Molecular Formula | C25H16Cl2N2O7 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | 4-[[2,4-dichloro-6-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C1NC(=O)N(c2ccc(O)cc2)C(=O)/C1=C/c1cc(Cl)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H16Cl2N2O7/c26-16-9-15(21(20(27)11-16)36-12-13-1-3-14(4-2-13)24(33)34)10-19-22(31)28-25(35)29(23(19)32)17-5-7-18(30)8-6-17/h1-11,30H,12H2,(H,33,34)(H,28,31,35)/b19-10+ |
| InChIKey | YVGKOGAUVTXWAY-VXLYETTFSA-N |
| XLogP | 4.64 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|