C32H23ClN2O7 — CID 126075156
4-[[2-chloro-6-methoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 126075156) has the molecular formula C32H23ClN2O7 and a molecular weight of 583.00 g/mol. Its IUPAC name is 4-[[2-chloro-6-methoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-6-methoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126075156 |
| Molecular Formula | C32H23ClN2O7 |
| Molecular Weight | 583.00 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | 4-[[2-chloro-6-methoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H23ClN2O7/c1-41-27-18-21(17-26(33)28(27)42-19-20-12-14-22(15-13-20)31(38)39)16-25-29(36)34(23-8-4-2-5-9-23)32(40)35(30(25)37)24-10-6-3-7-11-24/h2-18H,19H2,1H3,(H,38,39) |
| InChIKey | VMKPSXYLRNDPRK-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|