C30H20Cl2N2O4 — CID 126055158
5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126055158) has the molecular formula C30H20Cl2N2O4 and a molecular weight of 543.41 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126055158 |
| Molecular Formula | C30H20Cl2N2O4 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1C(=Cc2cc(Cl)c(OCc3ccccc3)c(Cl)c2)C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C30H20Cl2N2O4/c31-25-17-21(18-26(32)27(25)38-19-20-10-4-1-5-11-20)16-24-28(35)33(22-12-6-2-7-13-22)30(37)34(29(24)36)23-14-8-3-9-15-23/h1-18H,19H2 |
| InChIKey | SYWGAGQTKPVTBB-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|