C30H20I2N2O3S — CID 124600632
5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124600632) has the molecular formula C30H20I2N2O3S and a molecular weight of 742.38 g/mol. Its IUPAC name is 5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124600632 |
| Molecular Formula | C30H20I2N2O3S |
| Molecular Weight | 742.38 g/mol |
| Exact Mass | 741.93 |
| IUPAC Name | 5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1C(=Cc2cc(I)c(OCc3ccccc3)c(I)c2)C(=O)N(c2ccccc2)C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C30H20I2N2O3S/c31-25-17-21(18-26(32)27(25)37-19-20-10-4-1-5-11-20)16-24-28(35)33(22-12-6-2-7-13-22)30(38)34(29(24)36)23-14-8-3-9-15-23/h1-18H,19H2 |
| InChIKey | BGEXAUCFGCMDCW-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.38 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|