C18H12I2N2O4 — CID 3939140
5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 3939140) has the molecular formula C18H12I2N2O4 and a molecular weight of 574.11 g/mol. Its IUPAC name is 5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3939140 |
| Molecular Formula | C18H12I2N2O4 |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 573.89 |
| IUPAC Name | 5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2cc(I)c(OCc3ccccc3)c(I)c2)C(=O)N1 |
| InChI | InChI=1S/C18H12I2N2O4/c19-13-7-11(6-12-16(23)21-18(25)22-17(12)24)8-14(20)15(13)26-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,21,22,23,24,25) |
| InChIKey | GMHJHACILNQAPC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|