C24H17I3N2O3 — CID 126244261
(5E)-3-benzyl-5-[[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126244261) has the molecular formula C24H17I3N2O3 and a molecular weight of 762.12 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126244261 |
| Molecular Formula | C24H17I3N2O3 |
| Molecular Weight | 762.12 g/mol |
| Exact Mass | 761.84 |
| IUPAC Name | (5E)-3-benzyl-5-[[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(I)c(OCc3ccc(I)cc3)c(I)c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H17I3N2O3/c25-18-8-6-16(7-9-18)14-32-22-19(26)10-17(11-20(22)27)12-21-23(30)29(24(31)28-21)13-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,28,31)/b21-12+ |
| InChIKey | KEPHSHIDKPRUNE-CIAFOILYSA-N |
| XLogP | 6.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.12 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|