C24H19IN2O3 — CID 126240929
(5E)-3-benzyl-5-[(3-iodo-4-phenylmethoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 126240929) has the molecular formula C24H19IN2O3 and a molecular weight of 510.33 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[(3-iodo-4-phenylmethoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[(3-iodo-4-phenylmethoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126240929 |
| Molecular Formula | C24H19IN2O3 |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | (5E)-3-benzyl-5-[(3-iodo-4-phenylmethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccc(OCc3ccccc3)c(I)c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H19IN2O3/c25-20-13-19(11-12-22(20)30-16-18-9-5-2-6-10-18)14-21-23(28)27(24(29)26-21)15-17-7-3-1-4-8-17/h1-14H,15-16H2,(H,26,29)/b21-14+ |
| InChIKey | XWUYTYUPLOSPGS-KGENOOAVSA-N |
| XLogP | 4.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|