C19H16FIN2O3 — CID 126256171
(5E)-3-ethyl-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126256171) has the molecular formula C19H16FIN2O3 and a molecular weight of 466.25 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-ethyl-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126256171 |
| Molecular Formula | C19H16FIN2O3 |
| Molecular Weight | 466.25 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | (5E)-3-ethyl-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C/c2ccc(OCc3cccc(F)c3)c(I)c2)C1=O |
| InChI | InChI=1S/C19H16FIN2O3/c1-2-23-18(24)16(22-19(23)25)10-12-6-7-17(15(21)9-12)26-11-13-4-3-5-14(20)8-13/h3-10H,2,11H2,1H3,(H,22,25)/b16-10+ |
| InChIKey | VQEOEVQVCKUFDQ-MHWRWJLKSA-N |
| XLogP | 3.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|