C19H15I2N3O5 — CID 126235263
(5E)-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethylimidazolidine-2,4-dione (PubChem CID 126235263) has the molecular formula C19H15I2N3O5 and a molecular weight of 619.15 g/mol. Its IUPAC name is (5E)-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126235263 |
| Molecular Formula | C19H15I2N3O5 |
| Molecular Weight | 619.15 g/mol |
| Exact Mass | 618.91 |
| IUPAC Name | (5E)-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C/c2cc(I)c(OCc3cccc([N+](=O)[O-])c3)c(I)c2)C1=O |
| InChI | InChI=1S/C19H15I2N3O5/c1-2-23-18(25)16(22-19(23)26)9-12-7-14(20)17(15(21)8-12)29-10-11-4-3-5-13(6-11)24(27)28/h3-9H,2,10H2,1H3,(H,22,26)/b16-9+ |
| InChIKey | JGWKXGHTFKGQIH-CXUHLZMHSA-N |
| XLogP | 4.30 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.15 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|