C14H9I2NO4 — CID 4518004
3,5-diiodo-4-[(3-nitrophenyl)methoxy]benzaldehyde (PubChem CID 4518004) has the molecular formula C14H9I2NO4 and a molecular weight of 509.04 g/mol. Its IUPAC name is 3,5-diiodo-4-[(3-nitrophenyl)methoxy]benzaldehyde.
| Compound Name | 3,5-diiodo-4-[(3-nitrophenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 4518004 |
| Molecular Formula | C14H9I2NO4 |
| Molecular Weight | 509.04 g/mol |
| Exact Mass | 508.86 |
| IUPAC Name | 3,5-diiodo-4-[(3-nitrophenyl)methoxy]benzaldehyde |
| SMILES | O=Cc1cc(I)c(OCc2cccc([N+](=O)[O-])c2)c(I)c1 |
| InChI | InChI=1S/C14H9I2NO4/c15-12-5-10(7-18)6-13(16)14(12)21-8-9-2-1-3-11(4-9)17(19)20/h1-7H,8H2 |
| InChIKey | WITCYGZDCAYPJU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|