C21H18I2N2O5S — CID 126067229
(5Z)-3-butyl-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126067229) has the molecular formula C21H18I2N2O5S and a molecular weight of 664.26 g/mol. Its IUPAC name is (5Z)-3-butyl-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-butyl-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126067229 |
| Molecular Formula | C21H18I2N2O5S |
| Molecular Weight | 664.26 g/mol |
| Exact Mass | 663.90 |
| IUPAC Name | (5Z)-3-butyl-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCN1C(=O)S/C(=C\c2cc(I)c(OCc3cccc([N+](=O)[O-])c3)c(I)c2)C1=O |
| InChI | InChI=1S/C21H18I2N2O5S/c1-2-3-7-24-20(26)18(31-21(24)27)11-14-9-16(22)19(17(23)10-14)30-12-13-5-4-6-15(8-13)25(28)29/h4-6,8-11H,2-3,7,12H2,1H3/b18-11- |
| InChIKey | YOPWCYMXLLLLEX-WQRHYEAKSA-N |
| XLogP | 6.22 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.26 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|