C21H18FI2NO4S — CID 126234450
(5E)-5-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126234450) has the molecular formula C21H18FI2NO4S and a molecular weight of 653.25 g/mol. Its IUPAC name is (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126234450 |
| Molecular Formula | C21H18FI2NO4S |
| Molecular Weight | 653.25 g/mol |
| Exact Mass | 652.90 |
| IUPAC Name | (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COCCCN1C(=O)S/C(=C/c2cc(I)c(OCc3cccc(F)c3)c(I)c2)C1=O |
| InChI | InChI=1S/C21H18FI2NO4S/c1-28-7-3-6-25-20(26)18(30-21(25)27)11-14-9-16(23)19(17(24)10-14)29-12-13-4-2-5-15(22)8-13/h2,4-5,8-11H,3,6-7,12H2,1H3/b18-11+ |
| InChIKey | WLZWSQOQHGUWCW-WOJGMQOQSA-N |
| XLogP | 5.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.25 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|