C23H23FINO5S — CID 126244288
(5E)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126244288) has the molecular formula C23H23FINO5S and a molecular weight of 571.41 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126244288 |
| Molecular Formula | C23H23FINO5S |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CCCOC)C2=O)cc(I)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FINO5S/c1-3-30-19-12-16(13-20-22(27)26(23(28)32-20)9-4-10-29-2)11-18(25)21(19)31-14-15-5-7-17(24)8-6-15/h5-8,11-13H,3-4,9-10,14H2,1-2H3/b20-13+ |
| InChIKey | CALYQXVERWSLAH-DEDYPNTBSA-N |
| XLogP | 5.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|