C21H19FINO5S — CID 126061000
(5Z)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126061000) has the molecular formula C21H19FINO5S and a molecular weight of 543.35 g/mol. Its IUPAC name is (5Z)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126061000 |
| Molecular Formula | C21H19FINO5S |
| Molecular Weight | 543.35 g/mol |
| Exact Mass | 543.00 |
| IUPAC Name | (5Z)-5-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1c(I)cc(/C=C2\SC(=O)N(CCOc3ccc(F)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H19FINO5S/c1-3-28-19-16(23)10-13(11-17(19)27-2)12-18-20(25)24(21(26)30-18)8-9-29-15-6-4-14(22)5-7-15/h4-7,10-12H,3,8-9H2,1-2H3/b18-12- |
| InChIKey | TUYCJIBQKFWKQD-PDGQHHTCSA-N |
| XLogP | 4.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|