C28H25FINO5S — CID 126045927
(5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-[2-(4-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126045927) has the molecular formula C28H25FINO5S and a molecular weight of 633.48 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-[2-(4-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-[2-(4-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126045927 |
| Molecular Formula | C28H25FINO5S |
| Molecular Weight | 633.48 g/mol |
| Exact Mass | 633.05 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-[2-(4-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CCOc3ccc(C)cc3)C2=O)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C28H25FINO5S/c1-3-34-24-15-19(14-23(30)26(24)36-17-20-6-4-5-7-22(20)29)16-25-27(32)31(28(33)37-25)12-13-35-21-10-8-18(2)9-11-21/h4-11,14-16H,3,12-13,17H2,1-2H3/b25-16- |
| InChIKey | GULCDAJPLYARBA-XYGWBWBKSA-N |
| XLogP | 6.83 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|