C27H23F2NO5S — CID 126060569
(5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126060569) has the molecular formula C27H23F2NO5S and a molecular weight of 511.55 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126060569 |
| Molecular Formula | C27H23F2NO5S |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CCOc3ccc(F)cc3)C2=O)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C27H23F2NO5S/c1-2-33-24-15-18(7-12-23(24)35-17-19-5-3-4-6-22(19)29)16-25-26(31)30(27(32)36-25)13-14-34-21-10-8-20(28)9-11-21/h3-12,15-16H,2,13-14,17H2,1H3/b25-16- |
| InChIKey | SDDYIBPNGLUWJT-XYGWBWBKSA-N |
| XLogP | 6.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|