C21H20FIN2O3S — CID 124532179
(5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 124532179) has the molecular formula C21H20FIN2O3S and a molecular weight of 526.37 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 124532179 |
| Molecular Formula | C21H20FIN2O3S |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N/C)N(C)C2=O)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C21H20FIN2O3S/c1-4-27-17-10-13(11-18-20(26)25(3)21(24-2)29-18)9-16(23)19(17)28-12-14-7-5-6-8-15(14)22/h5-11H,4,12H2,1-3H3/b18-11-,24-21+ |
| InChIKey | ZWPSDBXRCDXRQI-USFSGSQCSA-N |
| XLogP | 4.94 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|