C28H23FIN3O3S — CID 126235847
2-[[2-ethoxy-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]methyl]benzonitrile (PubChem CID 126235847) has the molecular formula C28H23FIN3O3S and a molecular weight of 627.48 g/mol. Its IUPAC name is 2-[[2-ethoxy-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-ethoxy-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126235847 |
| Molecular Formula | C28H23FIN3O3S |
| Molecular Weight | 627.48 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | 2-[[2-ethoxy-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(F)cc3)N(CC)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C28H23FIN3O3S/c1-3-33-27(34)25(37-28(33)32-22-11-9-21(29)10-12-22)15-18-13-23(30)26(24(14-18)35-4-2)36-17-20-8-6-5-7-19(20)16-31/h5-15H,3-4,17H2,1-2H3/b25-15+,32-28- |
| InChIKey | SKNVFPJSQWSULV-RXILQIJYSA-N |
| XLogP | 6.90 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.48 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|