C19H15FI2N2O2S — CID 126254940
(5E)-5-[(3,5-diiodo-4-methoxyphenyl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126254940) has the molecular formula C19H15FI2N2O2S and a molecular weight of 608.21 g/mol. Its IUPAC name is (5E)-5-[(3,5-diiodo-4-methoxyphenyl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3,5-diiodo-4-methoxyphenyl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126254940 |
| Molecular Formula | C19H15FI2N2O2S |
| Molecular Weight | 608.21 g/mol |
| Exact Mass | 607.89 |
| IUPAC Name | (5E)-5-[(3,5-diiodo-4-methoxyphenyl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(I)c(OC)c(I)c2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15FI2N2O2S/c1-3-24-18(25)16(10-11-8-14(21)17(26-2)15(22)9-11)27-19(24)23-13-6-4-12(20)5-7-13/h4-10H,3H2,1-2H3/b16-10+,23-19- |
| InChIKey | QFQFJEIXYWBAMP-WASPXENMSA-N |
| XLogP | 5.67 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.21 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|