C22H19FI2N2O4S — CID 126250557
ethyl 2-[4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetate (PubChem CID 126250557) has the molecular formula C22H19FI2N2O4S and a molecular weight of 680.28 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetate |
|---|---|
| PubChem CID | 126250557 |
| Molecular Formula | C22H19FI2N2O4S |
| Molecular Weight | 680.28 g/mol |
| Exact Mass | 679.91 |
| IUPAC Name | ethyl 2-[4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2/S/C(=N\c3ccc(F)cc3)N(CC)C2=O)cc1I |
| InChI | InChI=1S/C22H19FI2N2O4S/c1-3-27-21(29)18(32-22(27)26-15-7-5-14(23)6-8-15)11-13-9-16(24)20(17(25)10-13)31-12-19(28)30-4-2/h5-11H,3-4,12H2,1-2H3/b18-11+,26-22- |
| InChIKey | BPYPFQDVAXIRCU-QCAKGMMDSA-N |
| XLogP | 5.60 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.28 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|